C8H16N2O4S — CID 103308426
N-cyclopropylsulfonyl-2-(2-methoxyethylamino)acetamide (PubChem CID 103308426) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-cyclopropylsulfonyl-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 103308426 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-cyclopropylsulfonyl-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C8H16N2O4S/c1-14-5-4-9-6-8(11)10-15(12,13)7-2-3-7/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | OHFYWFMPMXGUGU-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|