C12H12F6N2O — CID 103309035
N-[1-(3-aminophenyl)ethyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103309035) has the molecular formula C12H12F6N2O and a molecular weight of 314.23 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)ethyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-[1-(3-aminophenyl)ethyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103309035 |
| Molecular Formula | C12H12F6N2O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[1-(3-aminophenyl)ethyl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CC(NC(=O)C(C(F)(F)F)C(F)(F)F)c1cccc(N)c1 |
| InChI | InChI=1S/C12H12F6N2O/c1-6(7-3-2-4-8(19)5-7)20-10(21)9(11(13,14)15)12(16,17)18/h2-6,9H,19H2,1H3,(H,20,21) |
| InChIKey | CWXPBEADTFJIHD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|