C6H5F6NO4 — CID 103309195
2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]oxyacetic acid (PubChem CID 103309195) has the molecular formula C6H5F6NO4 and a molecular weight of 269.10 g/mol. Its IUPAC name is 2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]oxyacetic acid.
| Compound Name | 2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 103309195 |
| Molecular Formula | C6H5F6NO4 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F6NO4/c7-5(8,9)3(6(10,11)12)4(16)13-17-1-2(14)15/h3H,1H2,(H,13,16)(H,14,15) |
| InChIKey | GLARFZPZNXIIAY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|