C13H12FNO — CID 10330957
7-fluoro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 10330957) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 7-fluoro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | 7-fluoro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 10330957 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 7-fluoro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1CCC2=C(CCc3c(F)cccc32)N1 |
| InChI | InChI=1S/C13H12FNO/c14-11-3-1-2-8-9(11)4-6-12-10(8)5-7-13(16)15-12/h1-3H,4-7H2,(H,15,16) |
| InChIKey | HBMUZOKKGPWMJB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |