C12H12FN3 — CID 10330958
(1S,4S)-2-(5-ethynyl-6-fluoro-3-pyridinyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 10330958) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is (1S,4S)-2-(5-ethynyl-6-fluoro-3-pyridinyl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-(5-ethynyl-6-fluoro-3-pyridinyl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10330958 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (1S,4S)-2-(5-ethynyl-6-fluoro-3-pyridinyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | C#Cc1cc(N2C[C@@H]3C[C@H]2CN3)cnc1F |
| InChI | InChI=1S/C12H12FN3/c1-2-8-3-10(6-15-12(8)13)16-7-9-4-11(16)5-14-9/h1,3,6,9,11,14H,4-5,7H2/t9-,11-/m0/s1 |
| InChIKey | UTMVUYYCSVXPMM-ONGXEEELSA-N |
| XLogP | 0.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|