About 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol
3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol (PubChem CID 103309810) has the molecular formula C7H11F6NO
and a molecular weight of 239.16 g/mol. Its IUPAC name is 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol |
| PubChem CID | 103309810 |
| Molecular Formula | C7H11F6NO |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol |
| SMILES | OCCCNCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F6NO/c8-6(9,10)5(7(11,12)13)4-14-2-1-3-15/h5,14-15H,1-4H2 |
| InChIKey | SJCTTYSBFJAPKA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol?
The IUPAC name of 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol (CID 103309810) is 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol.
What is the SMILES notation for 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol?
The canonical SMILES for 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol is OCCCNCC(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol?
The InChIKey is SJCTTYSBFJAPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F6NO/c8-6(9,10)5(7(11,12)13)4-14-2-1-3-15/h5,14-15H,1-4H2.
What are the key properties of 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol?
3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol has a molecular weight of 239.16 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]propan-1-ol is sourced from PubChem (CID 103309810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).