C11H14F6N2OS — CID 103309895
N-(1-carbamothioylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103309895) has the molecular formula C11H14F6N2OS and a molecular weight of 336.30 g/mol. Its IUPAC name is N-(1-carbamothioylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(1-carbamothioylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103309895 |
| Molecular Formula | C11H14F6N2OS |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(1-carbamothioylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | NC(=S)C1(NC(=O)C(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H14F6N2OS/c12-10(13,14)6(11(15,16)17)7(20)19-9(8(18)21)4-2-1-3-5-9/h6H,1-5H2,(H2,18,21)(H,19,20) |
| InChIKey | KNGBFFCXUSWEOQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|