C10H6F6N2O2S — CID 103310508
3,3,3-trifluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)propanamide (PubChem CID 103310508) has the molecular formula C10H6F6N2O2S and a molecular weight of 332.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103310508 |
| Molecular Formula | C10H6F6N2O2S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3,3,3-trifluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)propanamide |
| SMILES | O=C(Nc1ncc(C#CCO)s1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F6N2O2S/c11-9(12,13)6(10(14,15)16)7(20)18-8-17-4-5(21-8)2-1-3-19/h4,6,19H,3H2,(H,17,18,20) |
| InChIKey | XDMFHNZZOFDYQB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|