C8H6F6N2O3 — CID 103310510
3-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid (PubChem CID 103310510) has the molecular formula C8H6F6N2O3 and a molecular weight of 292.14 g/mol. Its IUPAC name is 3-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid.
| Compound Name | 3-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 103310510 |
| Molecular Formula | C8H6F6N2O3 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1nnc(C(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C8H6F6N2O3/c9-7(10,11)5(8(12,13)14)6-16-15-3(19-6)1-2-4(17)18/h5H,1-2H2,(H,17,18) |
| InChIKey | SYBYEXLTLYJJMC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |