C10H13F6N3O2 — CID 103310878
1-ethoxy-2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 103310878) has the molecular formula C10H13F6N3O2 and a molecular weight of 321.22 g/mol. Its IUPAC name is 1-ethoxy-2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-ethoxy-2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 103310878 |
| Molecular Formula | C10H13F6N3O2 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-ethoxy-2-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CCOCC(C)(N)c1noc(C(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F6N3O2/c1-3-20-4-8(2,17)7-18-6(21-19-7)5(9(11,12)13)10(14,15)16/h5H,3-4,17H2,1-2H3 |
| InChIKey | QGWJJSTYIFQWPB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |