C6H5F6N3O — CID 103310907
[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 103310907) has the molecular formula C6H5F6N3O and a molecular weight of 249.11 g/mol. Its IUPAC name is [5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 103310907 |
| Molecular Formula | C6H5F6N3O |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | [5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(C(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C6H5F6N3O/c7-5(8,9)3(6(10,11)12)4-15-14-2(1-13)16-4/h3H,1,13H2 |
| InChIKey | ONLAHKVOMXXWRD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |