C9H11F6N3O — CID 103310910
N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine (PubChem CID 103310910) has the molecular formula C9H11F6N3O and a molecular weight of 291.20 g/mol. Its IUPAC name is N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103310910 |
| Molecular Formula | C9H11F6N3O |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(C(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C9H11F6N3O/c1-2-3-16-4-5-17-18-7(19-5)6(8(10,11)12)9(13,14)15/h6,16H,2-4H2,1H3 |
| InChIKey | YHKKYCUADCZGAT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|