C10H14BrF6NO — CID 103311045
N-[3-(bromomethyl)pentan-3-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103311045) has the molecular formula C10H14BrF6NO and a molecular weight of 358.12 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103311045 |
| Molecular Formula | C10H14BrF6NO |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCC(CC)(CBr)NC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14BrF6NO/c1-3-8(4-2,5-11)18-7(19)6(9(12,13)14)10(15,16)17/h6H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | IGCASQHSLWHJPU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|