C9H7ClF3N — CID 10331112
(E)-N-(1-chloro-2,2,2-trifluoroethyl)-1-phenylmethanimine (PubChem CID 10331112) has the molecular formula C9H7ClF3N and a molecular weight of 221.61 g/mol. Its IUPAC name is (E)-N-(1-chloro-2,2,2-trifluoroethyl)-1-phenylmethanimine.
| Compound Name | (E)-N-(1-chloro-2,2,2-trifluoroethyl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 10331112 |
| Molecular Formula | C9H7ClF3N |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (E)-N-(1-chloro-2,2,2-trifluoroethyl)-1-phenylmethanimine |
| SMILES | FC(F)(F)C(Cl)/N=C/c1ccccc1 |
| InChI | InChI=1S/C9H7ClF3N/c10-8(9(11,12)13)14-6-7-4-2-1-3-5-7/h1-6,8H/b14-6+ |
| InChIKey | HLBZDPWBZFLNGX-MKMNVTDBSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|