C10H10F6N2O — CID 103311183
N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]cyclopropanamine (PubChem CID 103311183) has the molecular formula C10H10F6N2O and a molecular weight of 288.19 g/mol. Its IUPAC name is N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 103311183 |
| Molecular Formula | C10H10F6N2O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)C(c1cnc(CNC2CC2)o1)C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2O/c11-9(12,13)8(10(14,15)16)6-3-18-7(19-6)4-17-5-1-2-5/h3,5,8,17H,1-2,4H2 |
| InChIKey | PEENHFJWEGVGAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |