C7H5ClF6N2S — CID 103311205
2-(1-chloroethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-thiadiazole (PubChem CID 103311205) has the molecular formula C7H5ClF6N2S and a molecular weight of 298.64 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-chloroethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 103311205 |
| Molecular Formula | C7H5ClF6N2S |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-(1-chloroethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3,4-thiadiazole |
| SMILES | CC(Cl)c1nnc(C(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H5ClF6N2S/c1-2(8)4-15-16-5(17-4)3(6(9,10)11)7(12,13)14/h2-3H,1H3 |
| InChIKey | AOLBDJKWCISXAB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|