C10H7F6NO3 — CID 103311248
4-cyclopropyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 103311248) has the molecular formula C10H7F6NO3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 4-cyclopropyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 4-cyclopropyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103311248 |
| Molecular Formula | C10H7F6NO3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-cyclopropyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1oc(C(C(F)(F)F)C(F)(F)F)nc1C1CC1 |
| InChI | InChI=1S/C10H7F6NO3/c11-9(12,13)6(10(14,15)16)7-17-4(3-1-2-3)5(20-7)8(18)19/h3,6H,1-2H2,(H,18,19) |
| InChIKey | KBHWVDYCQZNFTQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |