C11H13F6N3 — CID 103311323
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methyl-4,5,6,7-tetrahydrobenzimidazol-5-amine (PubChem CID 103311323) has the molecular formula C11H13F6N3 and a molecular weight of 301.23 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methyl-4,5,6,7-tetrahydrobenzimidazol-5-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methyl-4,5,6,7-tetrahydrobenzimidazol-5-amine |
|---|---|
| PubChem CID | 103311323 |
| Molecular Formula | C11H13F6N3 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1-methyl-4,5,6,7-tetrahydrobenzimidazol-5-amine |
| SMILES | Cn1c(C(C(F)(F)F)C(F)(F)F)nc2c1CCC(N)C2 |
| InChI | InChI=1S/C11H13F6N3/c1-20-7-3-2-5(18)4-6(7)19-9(20)8(10(12,13)14)11(15,16)17/h5,8H,2-4,18H2,1H3 |
| InChIKey | FDLCGZWWYRLKFE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |