C8H8F6N4O2S — CID 103311344
4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide (PubChem CID 103311344) has the molecular formula C8H8F6N4O2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103311344 |
| Molecular Formula | C8H8F6N4O2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(C(C(F)(F)F)C(F)(F)F)n1C1CC1 |
| InChI | InChI=1S/C8H8F6N4O2S/c9-7(10,11)4(8(12,13)14)5-16-17-6(21(15,19)20)18(5)3-1-2-3/h3-4H,1-2H2,(H2,15,19,20) |
| InChIKey | KHKPEWWIJIUOMF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |