C12H18N2O2 — CID 10331137
(2R,3R,4S)-2-[(benzylamino)methyl]pyrrolidine-3,4-diol (PubChem CID 10331137) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(benzylamino)methyl]pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-2-[(benzylamino)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10331137 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (2R,3R,4S)-2-[(benzylamino)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@H]1[C@@H](O)CN[C@@H]1CNCc1ccccc1 |
| InChI | InChI=1S/C12H18N2O2/c15-11-8-14-10(12(11)16)7-13-6-9-4-2-1-3-5-9/h1-5,10-16H,6-8H2/t10-,11+,12-/m1/s1 |
| InChIKey | SXQQUIDMNYCBEU-GRYCIOLGSA-N |
| XLogP | -0.53 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |