About N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine
N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine (PubChem CID 103311872) has the molecular formula C12H19F6NO
and a molecular weight of 307.28 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine |
| PubChem CID | 103311872 |
| Molecular Formula | C12H19F6NO |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine |
| SMILES | CCNC(CC1CCOCC1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H19F6NO/c1-2-19-9(7-8-3-5-20-6-4-8)10(11(13,14)15)12(16,17)18/h8-10,19H,2-7H2,1H3 |
| InChIKey | RMCIBDSWTNFQKF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine?
The IUPAC name of N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine (CID 103311872) is N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine.
What is the SMILES notation for N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine?
The canonical SMILES for N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine is CCNC(CC1CCOCC1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine?
The InChIKey is RMCIBDSWTNFQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F6NO/c1-2-19-9(7-8-3-5-20-6-4-8)10(11(13,14)15)12(16,17)18/h8-10,19H,2-7H2,1H3.
What are the key properties of N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine?
N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine has a molecular weight of 307.28 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4,4-trifluoro-1-(oxan-4-yl)-3-(trifluoromethyl)butan-2-amine is sourced from PubChem (CID 103311872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).