About 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine
6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine (PubChem CID 103311992) has the molecular formula C10H17F6NO2S
and a molecular weight of 329.31 g/mol. Its IUPAC name is 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine.
Molecular Properties
| Compound Name | 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine |
| PubChem CID | 103311992 |
| Molecular Formula | C10H17F6NO2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine |
| SMILES | CCS(=O)(=O)CCCC(NC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO2S/c1-3-20(18,19)6-4-5-7(17-2)8(9(11,12)13)10(14,15)16/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | ZKFFLOOFCAMOSF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine?
The IUPAC name of 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine (CID 103311992) is 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine.
What is the SMILES notation for 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine?
The canonical SMILES for 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine is CCS(=O)(=O)CCCC(NC)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine?
The InChIKey is ZKFFLOOFCAMOSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F6NO2S/c1-3-20(18,19)6-4-5-7(17-2)8(9(11,12)13)10(14,15)16/h7-8,17H,3-6H2,1-2H3.
What are the key properties of 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine?
6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine has a molecular weight of 329.31 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfonyl-1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hexan-3-amine is sourced from PubChem (CID 103311992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).