About N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine
N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine (PubChem CID 103312106) has the molecular formula C10H15F6N
and a molecular weight of 263.23 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine |
| PubChem CID | 103312106 |
| Molecular Formula | C10H15F6N |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine |
| SMILES | C=C(C)CC(NCC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F6N/c1-4-17-7(5-6(2)3)8(9(11,12)13)10(14,15)16/h7-8,17H,2,4-5H2,1,3H3 |
| InChIKey | IOFZWTZXPNLMTO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine?
The IUPAC name of N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine (CID 103312106) is N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine.
What is the SMILES notation for N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine?
The canonical SMILES for N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine is C=C(C)CC(NCC)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine?
The InChIKey is IOFZWTZXPNLMTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F6N/c1-4-17-7(5-6(2)3)8(9(11,12)13)10(14,15)16/h7-8,17H,2,4-5H2,1,3H3.
What are the key properties of N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine?
N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine has a molecular weight of 263.23 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-amine is sourced from PubChem (CID 103312106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).