About [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine
[5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine (PubChem CID 103312731) has the molecular formula C12H22F6N2
and a molecular weight of 308.31 g/mol. Its IUPAC name is [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine |
| PubChem CID | 103312731 |
| Molecular Formula | C12H22F6N2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine |
| SMILES | CCCCC(CC)CC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H22F6N2/c1-3-5-6-8(4-2)7-9(20-19)10(11(13,14)15)12(16,17)18/h8-10,20H,3-7,19H2,1-2H3 |
| InChIKey | SWKIQIQEBUAWQY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine?
The IUPAC name of [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine (CID 103312731) is [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine.
What is the SMILES notation for [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine?
The canonical SMILES for [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine is CCCCC(CC)CC(NN)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine?
The InChIKey is SWKIQIQEBUAWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F6N2/c1-3-5-6-8(4-2)7-9(20-19)10(11(13,14)15)12(16,17)18/h8-10,20H,3-7,19H2,1-2H3.
What are the key properties of [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine?
[5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine has a molecular weight of 308.31 g/mol, XLogP of 4.17, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)nonan-3-yl]hydrazine is sourced from PubChem (CID 103312731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).