C9H12F6N4 — CID 103312744
[4,4,4-trifluoro-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)butan-2-yl]hydrazine (PubChem CID 103312744) has the molecular formula C9H12F6N4 and a molecular weight of 290.21 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)butan-2-yl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103312744 |
| Molecular Formula | C9H12F6N4 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [4,4,4-trifluoro-1-(1-methylpyrazol-4-yl)-3-(trifluoromethyl)butan-2-yl]hydrazine |
| SMILES | Cn1cc(CC(NN)C(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H12F6N4/c1-19-4-5(3-17-19)2-6(18-16)7(8(10,11)12)9(13,14)15/h3-4,6-7,18H,2,16H2,1H3 |
| InChIKey | DKXBXMGJXYUECD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|