About [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine
[1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine (PubChem CID 103312773) has the molecular formula C10H18F6N2
and a molecular weight of 280.26 g/mol. Its IUPAC name is [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine |
| PubChem CID | 103312773 |
| Molecular Formula | C10H18F6N2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine |
| SMILES | CCCC(C)CC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H18F6N2/c1-3-4-6(2)5-7(18-17)8(9(11,12)13)10(14,15)16/h6-8,18H,3-5,17H2,1-2H3 |
| InChIKey | ADJUOHCFASQMKS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine?
The IUPAC name of [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine (CID 103312773) is [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine.
What is the SMILES notation for [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine?
The canonical SMILES for [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine is CCCC(C)CC(NN)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine?
The InChIKey is ADJUOHCFASQMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F6N2/c1-3-4-6(2)5-7(18-17)8(9(11,12)13)10(14,15)16/h6-8,18H,3-5,17H2,1-2H3.
What are the key properties of [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine?
[1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine has a molecular weight of 280.26 g/mol, XLogP of 3.39, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)octan-3-yl]hydrazine is sourced from PubChem (CID 103312773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).