C10H18F6N2 — CID 103312778
[1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)heptan-3-yl]hydrazine (PubChem CID 103312778) has the molecular formula C10H18F6N2 and a molecular weight of 280.26 g/mol. Its IUPAC name is [1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)heptan-3-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312778 |
| Molecular Formula | C10H18F6N2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)heptan-3-yl]hydrazine |
| SMILES | CC(C)(C)CCC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H18F6N2/c1-8(2,3)5-4-6(18-17)7(9(11,12)13)10(14,15)16/h6-7,18H,4-5,17H2,1-3H3 |
| InChIKey | BRALUUPXHXSFDK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|