About [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine
[1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine (PubChem CID 103312816) has the molecular formula C9H14F6N2
and a molecular weight of 264.21 g/mol. Its IUPAC name is [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine |
| PubChem CID | 103312816 |
| Molecular Formula | C9H14F6N2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine |
| SMILES | NNC(CC1CCC1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6N2/c10-8(11,12)7(9(13,14)15)6(17-16)4-5-2-1-3-5/h5-7,17H,1-4,16H2 |
| InChIKey | PRZDXVPFIIELIK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine?
The IUPAC name of [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine (CID 103312816) is [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine.
What is the SMILES notation for [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine?
The canonical SMILES for [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine is NNC(CC1CCC1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine?
The InChIKey is PRZDXVPFIIELIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F6N2/c10-8(11,12)7(9(13,14)15)6(17-16)4-5-2-1-3-5/h5-7,17H,1-4,16H2.
What are the key properties of [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine?
[1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine has a molecular weight of 264.21 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclobutyl-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine is sourced from PubChem (CID 103312816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).