About [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine
[6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine (PubChem CID 103312818) has the molecular formula C9H16F6N2O2S
and a molecular weight of 330.29 g/mol. Its IUPAC name is [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine |
| PubChem CID | 103312818 |
| Molecular Formula | C9H16F6N2O2S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H16F6N2O2S/c1-2-20(18,19)5-3-4-6(17-16)7(8(10,11)12)9(13,14)15/h6-7,17H,2-5,16H2,1H3 |
| InChIKey | VCJFAIORVHUTKS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine?
The IUPAC name of [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine (CID 103312818) is [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine.
What is the SMILES notation for [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine?
The canonical SMILES for [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine is CCS(=O)(=O)CCCC(NN)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine?
The InChIKey is VCJFAIORVHUTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F6N2O2S/c1-2-20(18,19)5-3-4-6(17-16)7(8(10,11)12)9(13,14)15/h6-7,17H,2-5,16H2,1H3.
What are the key properties of [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine?
[6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine has a molecular weight of 330.29 g/mol, XLogP of 1.77, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-ethylsulfonyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine is sourced from PubChem (CID 103312818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).