C7H9F9N2 — CID 103312831
[1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine (PubChem CID 103312831) has the molecular formula C7H9F9N2 and a molecular weight of 292.15 g/mol. Its IUPAC name is [1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine.
| Compound Name | [1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312831 |
| Molecular Formula | C7H9F9N2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexan-3-yl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F9N2/c8-5(9,10)2-1-3(18-17)4(6(11,12)13)7(14,15)16/h3-4,18H,1-2,17H2 |
| InChIKey | SEUPVOYVAQNVIM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|