About [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine
[3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312862) has the molecular formula C12H18F6N2O
and a molecular weight of 320.28 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine.
Molecular Properties
| Compound Name | [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine |
| PubChem CID | 103312862 |
| Molecular Formula | C12H18F6N2O |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(C1CCOC2(CCC2)C1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6N2O/c13-11(14,15)9(12(16,17)18)8(20-19)7-2-5-21-10(6-7)3-1-4-10/h7-9,20H,1-6,19H2 |
| InChIKey | BVLSXBSCVAXLLA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine?
The IUPAC name of [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine (CID 103312862) is [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine.
What is the SMILES notation for [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine?
The canonical SMILES for [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine is NNC(C1CCOC2(CCC2)C1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine?
The InChIKey is BVLSXBSCVAXLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F6N2O/c13-11(14,15)9(12(16,17)18)8(20-19)7-2-5-21-10(6-7)3-1-4-10/h7-9,20H,1-6,19H2.
What are the key properties of [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine?
[3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine has a molecular weight of 320.28 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3,3-trifluoro-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(trifluoromethyl)propyl]hydrazine is sourced from PubChem (CID 103312862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).