C11H11F7N2O — CID 103312886
[3,3,3-trifluoro-1-(2-fluoro-3-methoxyphenyl)-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312886) has the molecular formula C11H11F7N2O and a molecular weight of 320.21 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-(2-fluoro-3-methoxyphenyl)-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [3,3,3-trifluoro-1-(2-fluoro-3-methoxyphenyl)-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312886 |
| Molecular Formula | C11H11F7N2O |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [3,3,3-trifluoro-1-(2-fluoro-3-methoxyphenyl)-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | COc1cccc(C(NN)C(C(F)(F)F)C(F)(F)F)c1F |
| InChI | InChI=1S/C11H11F7N2O/c1-21-6-4-2-3-5(7(6)12)8(20-19)9(10(13,14)15)11(16,17)18/h2-4,8-9,20H,19H2,1H3 |
| InChIKey | MVCYHERQLUQGEG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|