About [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine
[1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312923) has the molecular formula C8H12F6N2
and a molecular weight of 250.19 g/mol. Its IUPAC name is [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
Molecular Properties
| Compound Name | [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| PubChem CID | 103312923 |
| Molecular Formula | C8H12F6N2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(C1CCC1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6N2/c9-7(10,11)6(8(12,13)14)5(16-15)4-2-1-3-4/h4-6,16H,1-3,15H2 |
| InChIKey | VAIHGLZHXHGXJI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine?
The IUPAC name of [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (CID 103312923) is [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
What is the SMILES notation for [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine?
The canonical SMILES for [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine is NNC(C1CCC1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine?
The InChIKey is VAIHGLZHXHGXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F6N2/c9-7(10,11)6(8(12,13)14)5(16-15)4-2-1-3-4/h4-6,16H,1-3,15H2.
What are the key properties of [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine?
[1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine has a molecular weight of 250.19 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclobutyl-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine is sourced from PubChem (CID 103312923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).