C12H20F6N2O — CID 103312928
[3,3,3-trifluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312928) has the molecular formula C12H20F6N2O and a molecular weight of 322.29 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [3,3,3-trifluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312928 |
| Molecular Formula | C12H20F6N2O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [3,3,3-trifluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)C(C(F)(F)F)C(F)(F)F)C(C)(C)O1 |
| InChI | InChI=1S/C12H20F6N2O/c1-9(2)5-6(10(3,4)21-9)7(20-19)8(11(13,14)15)12(16,17)18/h6-8,20H,5,19H2,1-4H3 |
| InChIKey | KSEXJFPYMCQVFT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|