C10H11F6N3O — CID 103312949
[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 103312949) has the molecular formula C10H11F6N3O and a molecular weight of 303.21 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 103312949 |
| Molecular Formula | C10H11F6N3O |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | OCC1CCc2nnc(C(C(F)(F)F)C(F)(F)F)n2C1 |
| InChI | InChI=1S/C10H11F6N3O/c11-9(12,13)7(10(14,15)16)8-18-17-6-2-1-5(4-20)3-19(6)8/h5,7,20H,1-4H2 |
| InChIKey | YGNMVQJUPVRCGO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |