C16H15IN2O — CID 103313143
3-(2-iodoanilino)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313143) has the molecular formula C16H15IN2O and a molecular weight of 378.21 g/mol. Its IUPAC name is 3-(2-iodoanilino)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(2-iodoanilino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313143 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 3-(2-iodoanilino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CCC1Nc1ccccc1I |
| InChI | InChI=1S/C16H15IN2O/c17-12-6-2-4-8-14(12)18-15-10-9-11-5-1-3-7-13(11)19-16(15)20/h1-8,15,18H,9-10H2,(H,19,20) |
| InChIKey | IEJSHHHTWFOQRO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|