C18H26N2O — CID 103313428
3-[[(1S)-1-cyclohexylethyl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313428) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[[(1S)-1-cyclohexylethyl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-[[(1S)-1-cyclohexylethyl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313428 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-[[(1S)-1-cyclohexylethyl]amino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | C[C@H](NC1CCc2ccccc2NC1=O)C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O/c1-13(14-7-3-2-4-8-14)19-17-12-11-15-9-5-6-10-16(15)20-18(17)21/h5-6,9-10,13-14,17,19H,2-4,7-8,11-12H2,1H3,(H,20,21)/t13-,17?/m0/s1 |
| InChIKey | WAWRCXIIBZYBKF-CWQZNGJJSA-N |
| XLogP | 3.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |