C17H18N2O2 — CID 103313850
3-[4-(methylamino)phenoxy]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313850) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[4-(methylamino)phenoxy]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-[4-(methylamino)phenoxy]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313850 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[4-(methylamino)phenoxy]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CNc1ccc(OC2CCc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-18-13-7-9-14(10-8-13)21-16-11-6-12-4-2-3-5-15(12)19-17(16)20/h2-5,7-10,16,18H,6,11H2,1H3,(H,19,20) |
| InChIKey | PWKINRMKBPBSQM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|