C14H11ClIN3O2 — CID 103313864
3-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313864) has the molecular formula C14H11ClIN3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is 3-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313864 |
| Molecular Formula | C14H11ClIN3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 3-(4-chloro-5-iodo-6-oxopyrimidin-1-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CCC1n1cnc(Cl)c(I)c1=O |
| InChI | InChI=1S/C14H11ClIN3O2/c15-12-11(16)14(21)19(7-17-12)10-6-5-8-3-1-2-4-9(8)18-13(10)20/h1-4,7,10H,5-6H2,(H,18,20) |
| InChIKey | XHHKXVXDOUFZIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|