C14H21NS — CID 103314461
3-butylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314461) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 3-butylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-butylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314461 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-butylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | CCCCSC1CCc2ccccc2NC1 |
| InChI | InChI=1S/C14H21NS/c1-2-3-10-16-13-9-8-12-6-4-5-7-14(12)15-11-13/h4-7,13,15H,2-3,8-11H2,1H3 |
| InChIKey | XPTJEJPAYZGZDD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|