C14H17NS — CID 10331472
3-pentyl-5-phenyl-1,2-thiazole (PubChem CID 10331472) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 3-pentyl-5-phenyl-1,2-thiazole.
| Compound Name | 3-pentyl-5-phenyl-1,2-thiazole |
|---|---|
| PubChem CID | 10331472 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-pentyl-5-phenyl-1,2-thiazole |
| SMILES | CCCCCc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C14H17NS/c1-2-3-5-10-13-11-14(16-15-13)12-8-6-4-7-9-12/h4,6-9,11H,2-3,5,10H2,1H3 |
| InChIKey | ZSJNPWVHGQVVIF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|