About benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate
benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (PubChem CID 10331712) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| PubChem CID | 10331712 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C12H15NO4/c14-10-6-13(7-11(10)15)12(16)17-8-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | OSDPRBVIIIGHPO-GHMZBOCLSA-N |
| XLogP | 0.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The IUPAC name of benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (CID 10331712) is benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1C[C@@H](O)[C@H](O)C1.
What is the InChIKey of benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The InChIKey is OSDPRBVIIIGHPO-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H15NO4/c14-10-6-13(7-11(10)15)12(16)17-8-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2/t10-,11-/m1/s1.
What are the key properties of benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate has a molecular weight of 237.25 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R,4R)-3,4-dihydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 10331712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).