About N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide
N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide (PubChem CID 10331765) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide |
| PubChem CID | 10331765 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide |
| SMILES | Cc1cc(=O)c(O)c(CNC(=O)C(C)C)n1C |
| InChI | InChI=1S/C12H18N2O3/c1-7(2)12(17)13-6-9-11(16)10(15)5-8(3)14(9)4/h5,7,16H,6H2,1-4H3,(H,13,17) |
| InChIKey | BOMJNMNLLPJGQR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide?
The IUPAC name of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide (CID 10331765) is N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide.
What is the SMILES notation for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide?
The canonical SMILES for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide is Cc1cc(=O)c(O)c(CNC(=O)C(C)C)n1C.
What is the InChIKey of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide?
The InChIKey is BOMJNMNLLPJGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-7(2)12(17)13-6-9-11(16)10(15)5-8(3)14(9)4/h5,7,16H,6H2,1-4H3,(H,13,17).
What are the key properties of N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide?
N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide has a molecular weight of 238.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-hydroxy-1,6-dimethyl-4-oxo-2-pyridinyl)methyl]-2-methylpropanamide is sourced from PubChem (CID 10331765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).