C10H9N5 — CID 103318526
3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-ylmethanamine (PubChem CID 103318526) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-ylmethanamine.
| Compound Name | 3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-ylmethanamine |
|---|---|
| PubChem CID | 103318526 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-ylmethanamine |
| SMILES | NCc1ccnc2c3cccnc3nn12 |
| InChI | InChI=1S/C10H9N5/c11-6-7-3-5-13-10-8-2-1-4-12-9(8)14-15(7)10/h1-5H,6,11H2 |
| InChIKey | RVXIWYCEBTVUGD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |