About (2-methyl-2-adamantyl) 2-chloroacetate
(2-methyl-2-adamantyl) 2-chloroacetate (PubChem CID 10332006) has the molecular formula C13H19ClO2
and a molecular weight of 242.75 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-chloroacetate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 2-chloroacetate |
| PubChem CID | 10332006 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-chloroacetate |
| SMILES | CC1(OC(=O)CCl)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H19ClO2/c1-13(16-12(15)7-14)10-3-8-2-9(5-10)6-11(13)4-8/h8-11H,2-7H2,1H3 |
| InChIKey | QDFWCECOXXZMBN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 2-chloroacetate?
The IUPAC name of (2-methyl-2-adamantyl) 2-chloroacetate (CID 10332006) is (2-methyl-2-adamantyl) 2-chloroacetate.
What is the SMILES notation for (2-methyl-2-adamantyl) 2-chloroacetate?
The canonical SMILES for (2-methyl-2-adamantyl) 2-chloroacetate is CC1(OC(=O)CCl)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 2-chloroacetate?
The InChIKey is QDFWCECOXXZMBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO2/c1-13(16-12(15)7-14)10-3-8-2-9(5-10)6-11(13)4-8/h8-11H,2-7H2,1H3.
What are the key properties of (2-methyl-2-adamantyl) 2-chloroacetate?
(2-methyl-2-adamantyl) 2-chloroacetate has a molecular weight of 242.75 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 2-chloroacetate is sourced from PubChem (CID 10332006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).