C16H20O2 — CID 10332077
(1R,2S,3'S)-3'-butyl-1-methylspiro[naphthalene-2,2'-oxirane]-1-ol (PubChem CID 10332077) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1R,2S,3'S)-3'-butyl-1-methylspiro[naphthalene-2,2'-oxirane]-1-ol.
| Compound Name | (1R,2S,3'S)-3'-butyl-1-methylspiro[naphthalene-2,2'-oxirane]-1-ol |
|---|---|
| PubChem CID | 10332077 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1R,2S,3'S)-3'-butyl-1-methylspiro[naphthalene-2,2'-oxirane]-1-ol |
| SMILES | CCCC[C@@H]1O[C@@]12C=Cc1ccccc1[C@@]2(C)O |
| InChI | InChI=1S/C16H20O2/c1-3-4-9-14-16(18-14)11-10-12-7-5-6-8-13(12)15(16,2)17/h5-8,10-11,14,17H,3-4,9H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | LBRQKJOSRCFZFN-XHSDSOJGSA-N |
| XLogP | 3.25 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|