C13H15N3S — CID 10332119
2,6-dimethyl-5,6-dihydro-1H-[1,2,4]triazino[3,4-d][1,5]benzothiazepine (PubChem CID 10332119) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2,6-dimethyl-5,6-dihydro-1H-[1,2,4]triazino[3,4-d][1,5]benzothiazepine.
| Compound Name | 2,6-dimethyl-5,6-dihydro-1H-[1,2,4]triazino[3,4-d][1,5]benzothiazepine |
|---|---|
| PubChem CID | 10332119 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,6-dimethyl-5,6-dihydro-1H-[1,2,4]triazino[3,4-d][1,5]benzothiazepine |
| SMILES | CC1=NN=C2CC(C)Sc3ccccc3N2C1 |
| InChI | InChI=1S/C13H15N3S/c1-9-8-16-11-5-3-4-6-12(11)17-10(2)7-13(16)15-14-9/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | YMOFXHHCUKJMDH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |