C16H23NO — CID 10332122
(7R,8S)-8-prop-2-enyl-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 10332122) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (7R,8S)-8-prop-2-enyl-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (7R,8S)-8-prop-2-enyl-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10332122 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (7R,8S)-8-prop-2-enyl-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | C=CC[C@H]1c2c(O)cccc2CC[C@H]1NCCC |
| InChI | InChI=1S/C16H23NO/c1-3-6-13-14(17-11-4-2)10-9-12-7-5-8-15(18)16(12)13/h3,5,7-8,13-14,17-18H,1,4,6,9-11H2,2H3/t13-,14-/m1/s1 |
| InChIKey | PYYAICINUKGGGB-ZIAGYGMSSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|