About N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide
N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide (PubChem CID 10332159) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide.
Molecular Properties
| Compound Name | N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide |
| PubChem CID | 10332159 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide |
| SMILES | CCC(=O)NCCCc1cccc2nc(C)oc12 |
| InChI | InChI=1S/C14H18N2O2/c1-3-13(17)15-9-5-7-11-6-4-8-12-14(11)18-10(2)16-12/h4,6,8H,3,5,7,9H2,1-2H3,(H,15,17) |
| InChIKey | NARZQXIFWXMPAP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide?
The IUPAC name of N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide (CID 10332159) is N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide.
What is the SMILES notation for N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide?
The canonical SMILES for N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide is CCC(=O)NCCCc1cccc2nc(C)oc12.
What is the InChIKey of N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide?
The InChIKey is NARZQXIFWXMPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-3-13(17)15-9-5-7-11-6-4-8-12-14(11)18-10(2)16-12/h4,6,8H,3,5,7,9H2,1-2H3,(H,15,17).
What are the key properties of N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide?
N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide has a molecular weight of 246.31 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-methyl-1,3-benzoxazol-7-yl)propyl]propanamide is sourced from PubChem (CID 10332159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).