C17H14N2 — CID 10332163
4-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaene (PubChem CID 10332163) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaene.
| Compound Name | 4-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 10332163 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-methyl-4,13-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaene |
| SMILES | Cn1cc2c(c1)-c1ccccc1Nc1ccccc1-2 |
| InChI | InChI=1S/C17H14N2/c1-19-10-14-12-6-2-4-8-16(12)18-17-9-5-3-7-13(17)15(14)11-19/h2-11,18H,1H3 |
| InChIKey | MMWNJKMPKQAUDE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |